ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate
ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate structure
|
Common Name | ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 66569-35-5 | Molecular Weight | 247.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H21NO3S |
|---|---|
| Molecular Weight | 247.35400 |
| Exact Mass | 247.12400 |
| PSA | 84.19000 |
| LogP | 2.63130 |
| InChIKey | FBADKLLASYLPNK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NC(C)=O)SCCC(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 2-acetami... CAS#:66569-35-5 |
| Literature: Ozaki,Y. et al. Journal of Organic Chemistry, 1979 , vol. 44, p. 391 - 395 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Acetyl-2-isoamylthioglycinethylester |
| Acetic acid,(acetylamino)[(3-methylbutyl)thio]-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: CAS number of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is 66569-35-5. |
| Q: What is the Chinese name of 66569-35-5? |
| A: Chinese name of 66569-35-5 is 66569-35-5. |
| Q: What are the upstream materials of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: Related upstream materials(CAS) of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate: 62183-05-5;541-31-1. |
| Q: What is the SMILES notation of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: SMILES notation of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is CCOC(=O)C(NC(C)=O)SCCC(C)C. |
| Q: What is the molecular formula of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: Molecular formula of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is C11H21NO3S. |
| Q: What is the InChIKey of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: InChIKey of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is FBADKLLASYLPNK-UHFFFAOYSA-N. |
| Q: What is the English name of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: The English name of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate. |
| Q: What is the molecular weight of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: Molecular weight of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is 247.35400. |
| Q: What is the LogP of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate? |
| A: LogP of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate is 2.63130. |
| Q: What English synonyms does ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate have? |
| A: English synonyms of ethyl 2-acetamido-2-(3-methylbutylsulfanyl)acetate: N-Acetyl-2-isoamylthioglycinethylester, Acetic acid,(acetylamino)[(3-methylbutyl)thio]-,ethyl ester. |