1,2,4-Butanetriol trinitrate
Modify Date: 2025-09-17 21:13:12
1,2,4-Butanetriol trinitrate structure
|
Common Name | 1,2,4-Butanetriol trinitrate | ||
|---|---|---|---|---|
| CAS Number | 6659-60-5 | Molecular Weight | 241.11300 | |
| Density | 1.582 g/cm3 | Boiling Point | 334.4ºC at 760 mmHg | |
| Molecular Formula | C4H7N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | 1,2,4-Butanetriol trinitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.582 g/cm3 |
|---|---|
| Boiling Point | 334.4ºC at 760 mmHg |
| Molecular Formula | C4H7N3O9 |
| Molecular Weight | 241.11300 |
| Flash Point | 162.4ºC |
| Exact Mass | 241.01800 |
| PSA | 165.15000 |
| LogP | 0.93960 |
| Index of Refraction | 1.487 |
| InChIKey | RDLIBIDNLZPAQD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| Hazard Class | 1.1A |
|---|---|
| HS Code | 2920909090 |
|
~80%
1,2,4-Butanetri... CAS#:6659-60-5 |
| Literature: ALLIANT TECHSYSTEMS INC. Patent: US2012/130115 A1, 2012 ; Location in patent: Page/Page column 5 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,4-dinitrooxybutan-2-yl nitrate |