4,6-Dichloroisophthalic acid structure
|
Common Name | 4,6-Dichloroisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 6660-65-7 | Molecular Weight | 235.021 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 437.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H4Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1±28.7 °C | |
| Name | 4,6-dichlorobenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.1±45.0 °C at 760 mmHg |
| Molecular Formula | C8H4Cl2O4 |
| Molecular Weight | 235.021 |
| Flash Point | 218.1±28.7 °C |
| Exact Mass | 233.948669 |
| PSA | 74.60000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | LJASDYRQBLUXEZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)c(Cl)cc1Cl |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid,4,6-dichloro |
| 4,6-dichloro-isophthalic acid |
| 4,6-dichloro-1,3-benzenedicarboxylic acid |
| 4,6-Dichloroisophthalic acid |
| 4,6-Dichlor-isophthalsaeure |