boc-phe-obzl structure
|
Common Name | boc-phe-obzl | ||
|---|---|---|---|---|
| CAS Number | 66617-58-1 | Molecular Weight | 355.42800 | |
| Density | 1.129g/cm3 | Boiling Point | 500.2ºC at 760mmHg | |
| Molecular Formula | C21H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.3ºC | |
| Name | boc-phe-obzl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 500.2ºC at 760mmHg |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.42800 |
| Flash Point | 256.3ºC |
| Exact Mass | 355.17800 |
| PSA | 64.63000 |
| LogP | 4.25670 |
| Index of Refraction | 1.547 |
| InChIKey | MBGXOZTZHRIZRO-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-phenylalanalyl-glycine |
| Boc-L-phenylalanylglycine |
| Boc-Phe-OBn |
| 2-tert-butoxycarbonylamino-3-phenylpropionic acid benzyl ester |
| N-Boc-ProGly |
| Boc-L-Phe-Gly-OH |
| Boc-Phe-Gly-OH |
| Boc-L-Phe-OBzl |