5-(4-fluorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid structure
|
Common Name | 5-(4-fluorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 66635-90-3 | Molecular Weight | 273.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-fluorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
|---|
| Molecular Formula | C15H12FNO3 |
|---|---|
| Molecular Weight | 273.25900 |
| Exact Mass | 273.08000 |
| PSA | 59.30000 |
| LogP | 2.43010 |
| InChIKey | QLPSJIRLKUYLSZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1ccc2n1CCC2C(=O)O |
|
Name: Minimum effective dose causing gastrointestinal erosion using seven-day chronic assay...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL785688
|
|
Name: Effective dose for rat paw assay
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL780547
|
|
Name: Antiinflammatory activity of compound determined by carrageenan rat paw edema assay
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771049
|
|
Name: Analgesic activity of compound using carrageenan mouse phenylquinone writhing assay
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL728347
|
|
Name: Effective dose causing 50 % gastrointestinal erosion using seven-day chronic assay.
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL781220
|
|
Name: Effective dose for mouse writhing assay
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL736032
|
|
Name: Antiinflammatory activity using cotton pellet assay
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771052
|
|
Name: Antiinflammatory activity using rat paw assay
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771053
|