1,3-benzodioxol-5-ylmethyl N-(2-chloro-4-nitrophenyl)carbamate structure
|
Common Name | 1,3-benzodioxol-5-ylmethyl N-(2-chloro-4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 6664-57-9 | Molecular Weight | 350.71100 | |
| Density | 1.561g/cm3 | Boiling Point | 470.7ºC at 760 mmHg | |
| Molecular Formula | C15H11ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4ºC | |
| Name | 1,3-benzodioxol-5-ylmethyl N-(2-chloro-4-nitrophenyl)carbamate |
|---|
| Density | 1.561g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760 mmHg |
| Molecular Formula | C15H11ClN2O6 |
| Molecular Weight | 350.71100 |
| Flash Point | 238.4ºC |
| Exact Mass | 350.03100 |
| PSA | 106.10000 |
| LogP | 4.26240 |
| Index of Refraction | 1.674 |
| InChIKey | CHBDBBXGHKHULN-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)OCc1ccc2c(c1)OCO2 |
|
~%
1,3-benzodioxol... CAS#:6664-57-9 |
| Literature: Sharma,S.C. Indian Journal of Chemistry, 1966 , vol. 4, p. 33 - 36 |
|
~%
1,3-benzodioxol... CAS#:6664-57-9 |
| Literature: Sharma,S.C. Indian Journal of Chemistry, 1966 , vol. 4, p. 33 - 36 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |