1-butyl-1-methyl-3-(3-methylphenyl)urea
Modify Date: 2025-10-02 18:37:34
1-butyl-1-methyl-3-(3-methylphenyl)urea structure
|
Common Name | 1-butyl-1-methyl-3-(3-methylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 6664-88-6 | Molecular Weight | 220.31100 | |
| Density | 1.038g/cm3 | Boiling Point | 378.6ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 1-butyl-1-methyl-3-(3-methylphenyl)urea |
|---|
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 378.6ºC at 760 mmHg |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.31100 |
| Flash Point | 182.7ºC |
| Exact Mass | 220.15800 |
| PSA | 35.83000 |
| LogP | 3.27240 |
| Index of Refraction | 1.55 |
| InChIKey | BNDJXSVCECVGMF-UHFFFAOYSA-N |
| SMILES | CCCCN(C)C(=O)Nc1cccc(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |