N-formyl 4-ANPP
Modify Date: 2026-08-23 12:05:06
N-formyl 4-ANPP structure
|
Common Name | N-formyl 4-ANPP | ||
|---|---|---|---|---|
| CAS Number | 66670-15-3 | Molecular Weight | 308.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-formyl 4-ANPP |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N2O |
|---|---|
| Molecular Weight | 308.4 |
| InChIKey | TXSDBUXSIGJETF-UHFFFAOYSA-N |
| SMILES | O=CN(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-formyl 4-ANPP? |
| A: The English name of N-formyl 4-ANPP is N-formyl 4-ANPP. |
| Q: What is the SMILES notation of N-formyl 4-ANPP? |
| A: SMILES notation of N-formyl 4-ANPP is O=CN(c1ccccc1)C1CCN(CCc2ccccc2)CC1. |
| Q: What is the CAS number of N-formyl 4-ANPP? |
| A: CAS number of N-formyl 4-ANPP is 66670-15-3. |
| Q: What is the InChIKey of N-formyl 4-ANPP? |
| A: InChIKey of N-formyl 4-ANPP is TXSDBUXSIGJETF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 66670-15-3? |
| A: Chinese name of 66670-15-3 is 66670-15-3. |
| Q: What is the molecular weight of N-formyl 4-ANPP? |
| A: Molecular weight of N-formyl 4-ANPP is 308.4. |
| Q: What is the molecular formula of N-formyl 4-ANPP? |
| A: Molecular formula of N-formyl 4-ANPP is C20H24N2O. |