3-(4-chlorophenyl)-2-hydrazinylquinazolin-4-one structure
|
Common Name | 3-(4-chlorophenyl)-2-hydrazinylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 66679-74-1 | Molecular Weight | 286.71600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)-2-hydrazinylquinazolin-4-one |
|---|
| Molecular Formula | C14H11ClN4O |
|---|---|
| Molecular Weight | 286.71600 |
| Exact Mass | 286.06200 |
| PSA | 72.94000 |
| LogP | 3.09800 |
| InChIKey | YAMNSMFURVBGBK-UHFFFAOYSA-N |
| SMILES | NNc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
|
~81%
3-(4-chlorophen... CAS#:66679-74-1 |
| Literature: Alagarsamy; Giridhar, Rajani; Yadav Journal of Pharmacy and Pharmacology, 2006 , vol. 58, # 9 p. 1249 - 1255 |
|
~%
3-(4-chlorophen... CAS#:66679-74-1 |
| Literature: Alagarsamy; Giridhar, Rajani; Yadav Journal of Pharmacy and Pharmacology, 2006 , vol. 58, # 9 p. 1249 - 1255 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |