methyl (2R)-2-[[(2S,3R)-3-acetyloxy-2-[[9-[[2-acetyloxy-1-[(1-methoxycarbonyl-2-methyl-propyl)carbamoyl]propyl]carbamoyl]-2-amino-4,6-dimethyl-3-oxo-phenoxazine-1-carbonyl]amino]butanoyl]amino]-3-meth
![methyl (2R)-2-[[(2S,3R)-3-acetyloxy-2-[[9-[[2-acetyloxy-1-[(1-methoxycarbonyl-2-methyl-propyl)carbamoyl]propyl]carbamoyl]-2-amino-4,6-dimethyl-3-oxo-phenoxazine-1-carbonyl]amino]butanoyl]amino]-3-meth Structure](https://image.chemsrc.com/caspic/302/66682-45-9.png)
methyl (2R)-2-[[(2S,3R)-3-acetyloxy-2-[[9-[[2-acetyloxy-1-[(1-methoxycarbonyl-2-methyl-propyl)carbamoyl]propyl]carbamoyl]-2-amino-4,6-dimethyl-3-oxo-phenoxazine-1-carbonyl]amino]butanoyl]amino]-3-meth structure
|
Common Name | methyl (2R)-2-[[(2S,3R)-3-acetyloxy-2-[[9-[[2-acetyloxy-1-[(1-methoxycarbonyl-2-methyl-propyl)carbamoyl]propyl]carbamoyl]-2-amino-4,6-dimethyl-3-oxo-phenoxazine-1-carbonyl]amino]butanoyl]amino]-3-meth | ||
|---|---|---|---|---|
| CAS Number | 66682-45-9 | Molecular Weight | 840.87300 | |
| Density | 1.38g/cm3 | Boiling Point | 956.8ºC at 760 mmHg | |
| Molecular Formula | C40H52N6O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 532.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | actinomycin analog |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 956.8ºC at 760 mmHg |
| Molecular Formula | C40H52N6O14 |
| Molecular Weight | 840.87300 |
| Flash Point | 532.5ºC |
| Exact Mass | 840.35400 |
| PSA | 290.72000 |
| LogP | 3.36420 |
| Index of Refraction | 1.604 |
| InChIKey | GQTDBQIBBFMULZ-YRLWXYAYSA-N |
| SMILES | COC(=O)C(NC(=O)C(NC(=O)c1c2nc3c(C(=O)NC(C(=O)NC(C(=O)OC)C(C)C)C(C)OC(C)=O)ccc(C)c3oc-2c(C)c(=O)c1N)C(C)OC(C)=O)C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl (2R)-2-[... CAS#:66682-45-9 |
| Literature: Chowdhury,A.K.A. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 607 - 612 |
![N-[O-acetyl-N-(3-benzyloxy-4-methyl-2-nitro-benzoyl)-Ls-threonyl]-D-valine methyl ester structure](https://image.chemsrc.com/caspic/209/66682-52-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of actinomycin analog? |
| A: Boiling point of actinomycin analog is 956.8ºC at 760 mmHg. |
| Q: What is the English name of actinomycin analog? |
| A: The English name of actinomycin analog is actinomycin analog. |
| Q: What is the molecular formula of actinomycin analog? |
| A: Molecular formula of actinomycin analog is C40H52N6O14. |
| Q: What are the upstream materials of actinomycin analog? |
| A: Related upstream materials(CAS) of actinomycin analog: 66682-52-8. |
| Q: What is the molecular weight of actinomycin analog? |
| A: Molecular weight of actinomycin analog is 840.87300. |
| Q: What is the SMILES notation of actinomycin analog? |
| A: SMILES notation of actinomycin analog is COC(=O)C(NC(=O)C(NC(=O)c1c2nc3c(C(=O)NC(C(=O)NC(C(=O)OC)C(C)C)C(C)OC(C)=O)ccc(C)c3oc-2c(C)c(=O)c1N)C(C)OC(C)=O)C(C)C. |
| Q: What is the LogP of actinomycin analog? |
| A: LogP of actinomycin analog is 3.36420. |
| Q: What is the InChIKey of actinomycin analog? |
| A: InChIKey of actinomycin analog is GQTDBQIBBFMULZ-YRLWXYAYSA-N. |
| Q: What is the Chinese name of 66682-45-9? |
| A: Chinese name of 66682-45-9 is 66682-45-9. |
| Q: What is the polar surface area (PSA) of actinomycin analog? |
| A: Polar surface area (PSA) of actinomycin analog is 290.72000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |