methyl (2R)-2-[[(2S,3R)-3-acetyloxy-2-[[9-[[2-acetyloxy-1-[(1-methoxycarbonyl-2-methyl-propyl)carbamoyl]propyl]carbamoyl]-2-amino-4,6-dimethyl-3-oxo-phenoxazine-1-carbonyl]amino]butanoyl]amino]-3-meth structure
|
Common Name | methyl (2R)-2-[[(2S,3R)-3-acetyloxy-2-[[9-[[2-acetyloxy-1-[(1-methoxycarbonyl-2-methyl-propyl)carbamoyl]propyl]carbamoyl]-2-amino-4,6-dimethyl-3-oxo-phenoxazine-1-carbonyl]amino]butanoyl]amino]-3-meth | ||
|---|---|---|---|---|
| CAS Number | 66682-45-9 | Molecular Weight | 840.87300 | |
| Density | 1.38g/cm3 | Boiling Point | 956.8ºC at 760 mmHg | |
| Molecular Formula | C40H52N6O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 532.5ºC | |
| Name | actinomycin analog |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 956.8ºC at 760 mmHg |
| Molecular Formula | C40H52N6O14 |
| Molecular Weight | 840.87300 |
| Flash Point | 532.5ºC |
| Exact Mass | 840.35400 |
| PSA | 290.72000 |
| LogP | 3.36420 |
| Index of Refraction | 1.604 |
| InChIKey | GQTDBQIBBFMULZ-YRLWXYAYSA-N |
| SMILES | COC(=O)C(NC(=O)C(NC(=O)c1c2nc3c(C(=O)NC(C(=O)NC(C(=O)OC)C(C)C)C(C)OC(C)=O)ccc(C)c3oc-2c(C)c(=O)c1N)C(C)OC(C)=O)C(C)C |
|
~%
methyl (2R)-2-[... CAS#:66682-45-9 |
| Literature: Chowdhury,A.K.A. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 607 - 612 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |