2,6-dimethoxy-4-pent-1-enylphenol structure
|
Common Name | 2,6-dimethoxy-4-pent-1-enylphenol | ||
|---|---|---|---|---|
| CAS Number | 666849-01-0 | Molecular Weight | 222.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethoxy-4-pent-1-enylphenol |
|---|
| Molecular Formula | C13H18O3 |
|---|---|
| Molecular Weight | 222.28000 |
| Exact Mass | 222.12600 |
| PSA | 38.69000 |
| LogP | 3.22270 |
| InChIKey | UASVUMYMCCPTDW-UHFFFAOYSA-N |
| SMILES | CCCC=Cc1cc(OC)c(O)c(OC)c1 |
|
~%
2,6-dimethoxy-4... CAS#:666849-01-0 |
| Literature: Grabowski, Slawomir J.; Pfitzner, Arno; Zabel, Manfred; Dubis, Alina T.; Palusiak, Marcin Journal of Physical Chemistry B, 2004 , vol. 108, # 6 p. 1831 - 1837 |
|
~%
2,6-dimethoxy-4... CAS#:666849-01-0 |
| Literature: Grabowski, Slawomir J.; Pfitzner, Arno; Zabel, Manfred; Dubis, Alina T.; Palusiak, Marcin Journal of Physical Chemistry B, 2004 , vol. 108, # 6 p. 1831 - 1837 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |