Benzene,1-(2-bromoethoxy)-2,3,4,5,6-pentafluoro-
Modify Date: 2025-09-01 05:31:24
Benzene,1-(2-bromoethoxy)-2,3,4,5,6-pentafluoro- structure
|
Common Name | Benzene,1-(2-bromoethoxy)-2,3,4,5,6-pentafluoro- | ||
|---|---|---|---|---|
| CAS Number | 6669-01-8 | Molecular Weight | 291.01300 | |
| Density | 1.772g/cm3 | Boiling Point | 235.6ºC at 760 mmHg | |
| Molecular Formula | C8H4BrF5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.9ºC | |
| Name | 1-(2-bromoethoxy)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.772g/cm3 |
|---|---|
| Boiling Point | 235.6ºC at 760 mmHg |
| Molecular Formula | C8H4BrF5O |
| Molecular Weight | 291.01300 |
| Flash Point | 116.9ºC |
| Exact Mass | 289.93700 |
| PSA | 9.23000 |
| LogP | 3.15580 |
| Index of Refraction | 1.463 |
| InChIKey | DZKOVQHPLXTXML-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(OCCBr)c(F)c1F |
| HS Code | 2909309090 |
|---|
|
~10%
Benzene,1-(2-br... CAS#:6669-01-8 |
| Literature: CENGENT THERAPEUTICS; RIDEOUT, Darryl; VLADIMIR, Tseitin; SHENDEROVICH, Mark; SEMPLE, Edward; NUTT, Ruth, F.; VENKATACHALAPATHI, Yalamoori; CHUNG-YING, Tsai; DE LUNA, Michelle, G.; BRADY, Thomas, P.; WU, Feiyue Patent: WO2005/27856 A2, 2005 ; Location in patent: Page/Page column 55 ; |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Pentafluorphenoxy-aethylbromid |
| 2-bromoethyl pentafluorophenyl ether |
| 2-Perfluorphenoxy-ethylbromid |