N,N-bis(2-chloroethyl)-4-(4-nitrophenyl)diazenyl-aniline structure
|
Common Name | N,N-bis(2-chloroethyl)-4-(4-nitrophenyl)diazenyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 66710-74-5 | Molecular Weight | 367.23000 | |
| Density | 1.32g/cm3 | Boiling Point | 550.3ºC at 760 mmHg | |
| Molecular Formula | C16H16Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.6ºC | |
| Name | N,N-bis(2-chloroethyl)-4-[(4-nitrophenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 550.3ºC at 760 mmHg |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.23000 |
| Flash Point | 286.6ºC |
| Exact Mass | 366.06500 |
| PSA | 73.78000 |
| LogP | 5.81740 |
| Index of Refraction | 1.609 |
| InChIKey | QUUTZFNLPATCQR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(N(CCCl)CCCl)cc2)cc1 |
|
~80%
N,N-bis(2-chlor... CAS#:66710-74-5 |
| Literature: Kolli, Balakrishna; Mishra, Sarada P.; Joshi; Raj Mohan; Dhami; Samui Journal of Polymer Science, Part A: Polymer Chemistry, 2012 , vol. 50, # 8 p. 1572 - 1578 |
|
~%
N,N-bis(2-chlor... CAS#:66710-74-5 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N-bis-(2-chloro-ethyl)-4-(4-nitro-phenylazo)-aniline |
| 4'-Nitro-4-[bis-(2-chlor-aethyl)-amino]-azobenzol |
| N,N-Bis-(2-chlor-aethyl)-4-(4-nitro-phenylazo)-anilin |
| Benzenamine,N,N-bis(2-chloroethyl)-4-[(4-nitrophenyl)azo] |
| 4-nitro-4'-[bis(2-chloroethyl)amino]azobenzene |
| N,N-Bis(2-chloroethyl)-4-[(E)-(4-nitrophenyl)diazenyl]aniline |