8-Chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 8-Chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 667437-81-2 | Molecular Weight | 297.73600 | |
| Density | 1.336g/cm3 | Boiling Point | 474.8ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.9ºC | |
| Name | 8-Chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid |
|---|
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 474.8ºC at 760 mmHg |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.73600 |
| Flash Point | 240.9ºC |
| Exact Mass | 297.05600 |
| PSA | 50.19000 |
| LogP | 4.56180 |
| Index of Refraction | 1.672 |
| InChIKey | CWPFJURJTLDVFY-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1cc(C(=O)O)c2cccc(Cl)c2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |