5-benzyl-3-phenoxathiin-2-yl-1H-pyridazin-6-one structure
|
Common Name | 5-benzyl-3-phenoxathiin-2-yl-1H-pyridazin-6-one | ||
|---|---|---|---|---|
| CAS Number | 667466-69-5 | Molecular Weight | 384.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzyl-3-phenoxathiin-2-yl-1H-pyridazin-6-one |
|---|
| Molecular Formula | C23H16N2O2S |
|---|---|
| Molecular Weight | 384.45000 |
| Exact Mass | 384.09300 |
| PSA | 80.54000 |
| LogP | 5.69690 |
| InChIKey | GNHOJMDXZQLCRV-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(-c2ccc3c(c2)Sc2ccccc2O3)cc1Cc1ccccc1 |
|
~85%
5-benzyl-3-phen... CAS#:667466-69-5 |
| Literature: Aly; Wasfy Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 3 p. 629 - 635 |
|
~%
5-benzyl-3-phen... CAS#:667466-69-5 |
| Literature: Aly; Wasfy Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 3 p. 629 - 635 |