2H-1,5-Benzodiazepin-2-one, 1,3-dihydro-4-(4-(phenylthio)phenyl)- structure
|
Common Name | 2H-1,5-Benzodiazepin-2-one, 1,3-dihydro-4-(4-(phenylthio)phenyl)- | ||
|---|---|---|---|---|
| CAS Number | 66752-99-6 | Molecular Weight | 344.43000 | |
| Density | 1.24g/cm3 | Boiling Point | 565.9ºC at 760 mmHg | |
| Molecular Formula | C21H16N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.1ºC | |
| Name | 4-(4-phenylsulfanylphenyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 565.9ºC at 760 mmHg |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.43000 |
| Flash Point | 296.1ºC |
| Exact Mass | 344.09800 |
| PSA | 70.25000 |
| LogP | 4.82150 |
| Index of Refraction | 1.671 |
| InChIKey | ILVFCQWJKBGQBJ-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(Sc3ccccc3)cc2)=Nc2ccccc2N1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-p-Phenylthiophenyl-1,3-dihydro-2H-1,5-benzodiazepin-2-one |