trimethyl-(2-methyl-5-propan-2-ylphenoxy)silane structure
|
Common Name | trimethyl-(2-methyl-5-propan-2-ylphenoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 66760-13-2 | Molecular Weight | 222.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-methyl-5-propan-2-ylphenoxy)silane |
|---|
| Molecular Formula | C13H22OSi |
|---|---|
| Molecular Weight | 222.39900 |
| Exact Mass | 222.14400 |
| PSA | 9.23000 |
| LogP | 4.33210 |
| InChIKey | WJJLDAJDILRAIQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)cc1O[Si](C)(C)C |
|
~94%
trimethyl-(2-me... CAS#:66760-13-2 |
| Literature: Mishra; Singh Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2001 , vol. 40, # 7 p. 772 - 774 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |