10-formyl-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid structure
|
Common Name | 10-formyl-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 668-14-4 | Molecular Weight | 358.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-formyl-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14O8 |
|---|---|
| Molecular Weight | 358.29900 |
| Exact Mass | 358.06900 |
| PSA | 130.36000 |
| LogP | 2.85860 |
| InChIKey | FOKAHYDSEWGOHN-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C=O)c2c1C(=O)Oc1c(C)c(O)c(C(=O)O)c(C)c1O2 |
|
Name: Inhibitory concentration of compound against disintegration (reversal of strand trans...
Source: ChEMBL
Target: Integrase
External Id: CHEMBL701793
|
|
Name: Percentage inhibition of compound against 3'-processing of HIV-1 integrase at 100 ug/...
Source: ChEMBL
Target: Integrase
External Id: CHEMBL700695
|
|
Name: Percentage inhibition against strand transfer of HIV-1 integrase at 100 ug/mL
Source: ChEMBL
Target: Integrase
External Id: CHEMBL700696
|
| Granulatine |
| virensic acid |
| acide virensique |