Tricyclo[1.1.0.02,4]butane,tetrakis(t-butyl) structure
|
Common Name | Tricyclo[1.1.0.02,4]butane,tetrakis(t-butyl) | ||
|---|---|---|---|---|
| CAS Number | 66809-06-1 | Molecular Weight | 276.50000 | |
| Density | 0.998g/cm3 | Boiling Point | 283.7ºC at 760 mmHg | |
| Molecular Formula | C20H36 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.6ºC | |
| Name | tetra-tert-butyltetrahedrane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 283.7ºC at 760 mmHg |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.50000 |
| Flash Point | 126.6ºC |
| Exact Mass | 276.28200 |
| LogP | 6.15720 |
| Index of Refraction | 1.54 |
| InChIKey | XMHGFBLEMNQVKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C12C3(C(C)(C)C)C1(C(C)(C)C)C23C(C)(C)C |
| HS Code | 2902199090 |
|---|
| HS Code | 2902199090 |
|---|---|
| Summary | 2902199090 other cyclanes, cyclenes and cyclotherpenes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| Tricyclo[1.1.0.02,4]butane,tetrakis(t-butyl) |
| 1,2,3,4-tetra-tert-butyltricyclo[1.1.0.0(2,4)]butane |
| tetrakis(1,1-dimethylethyl)tricyclo[1.1.0.0(2,4)]butane |
| tetrakis(t-butyl)tricyclo[1.1.0.0(2,4)]butane |
| Tricyclo[1.1.0.02,4]butane,tetrakis(1,1-dimethylethyl) |
| Tetra-tert-butyltetrahedrane |
| Tetra-tert-butyltetrahedarane |
| Tetra-tert-butyltetrahedran |