2-chloro-3,4,4,5,5-pentafluorocyclopent-2-en-1-one structure
|
Common Name | 2-chloro-3,4,4,5,5-pentafluorocyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 6681-60-3 | Molecular Weight | 206.49800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5ClF5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3,4,4,5,5-pentafluorocyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5ClF5O |
|---|---|
| Molecular Weight | 206.49800 |
| Exact Mass | 205.95600 |
| PSA | 17.07000 |
| LogP | 2.25960 |
| InChIKey | ZXYQVSHKEFPNKY-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(F)C(F)(F)C1(F)F |
|
~%
2-chloro-3,4,4,... CAS#:6681-60-3 |
| Literature: Scherer,O. et al. Chemische Berichte, 1966 , vol. 99, p. 1966 - 1972 |
|
~%
2-chloro-3,4,4,... CAS#:6681-60-3 |
| Literature: Smart,B.E.; Krespan,C.G. Journal of the American Chemical Society, 1977 , vol. 99, p. 1218 - 1221 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4,4,5,5-Pentafluor-2-chlor-cyclopent-1-en-3-on |
| 2-chloro-3,4,4,5,5-pentafluoro-cyclopent-2-enone |
| 2,3,3,4,4-Pentafluor-1-chlor-5-oxocyclopenten |
| 2-Cyclopenten-1-one,2-chloro-3,4,4,5,5-pentafluoro |
| 2-Chlorpentafluor-2-cyclopenten-1-on |
| 2-Chlorpentafluorcyclopent-2-en-1-on |