2-(2-Bromoallyl)-2-phenylacetic acid 3-(diethylamino)-2,2-dimethylpropyl ester structure
|
Common Name | 2-(2-Bromoallyl)-2-phenylacetic acid 3-(diethylamino)-2,2-dimethylpropyl ester | ||
|---|---|---|---|---|
| CAS Number | 66827-51-8 | Molecular Weight | 396.36200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(diethylamino)-2,2-dimethylpropyl] 4-bromo-2-phenylpent-4-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H30BrNO2 |
|---|---|
| Molecular Weight | 396.36200 |
| Exact Mass | 395.14600 |
| PSA | 29.54000 |
| LogP | 4.98010 |
| InChIKey | ULBPJZCMKCOMJF-UHFFFAOYSA-N |
| SMILES | C=C(Br)CC(C(=O)OCC(C)(C)CN(CC)CC)c1ccccc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetic acid,2-(2-bromoallyl)-2-phenyl-,3-(diethylamino)-2,2-dimethylpropyl ester |
| Phenylbromoallyl-essigsaeureester des 3-diaethylamino-2,2-dimethyl-1-propanol [German] |
| Phenylbromoallyl-essigsaeureester des 3-diaethylamino-2,2-dimethyl-1-propanol |
| 2-(2-Bromoallyl)-2-phenylacetic acid 3-(diethylamino)-2,2-dimethylpropyl ester |