8-chloro-2-phenyl-2,3-dihydrochromen-4-one structure
|
Common Name | 8-chloro-2-phenyl-2,3-dihydrochromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 66883-86-1 | Molecular Weight | 258.70000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-chloro-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11ClO2 |
|---|---|
| Molecular Weight | 258.70000 |
| Exact Mass | 258.04500 |
| PSA | 26.30000 |
| LogP | 4.04650 |
| InChIKey | XQROCKZRCAVBQI-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)Oc2c(Cl)cccc21 |
|
~%
8-chloro-2-phen... CAS#:66883-86-1 |
| Literature: Parikh; Shah Journal of the Indian Chemical Society, 1959 , vol. 36, p. 729 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-chloro-2-phenyl-chroman-4-one |
| 8-chloroflavanone |
| 4H-1-Benzopyran-4-one,8-chloro-2,3-dihydro-2-phenyl |
| 8-Chlor-2-phenyl-chroman-4-on |