5-(3,4-Dimethoxyphenyl)oxazolidin-2-one structure
|
Common Name | 5-(3,4-Dimethoxyphenyl)oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 66892-82-8 | Molecular Weight | 223.22500 | |
| Density | 1.21g/cm3 | Boiling Point | 445.9ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 5-(3,4-dimethoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 445.9ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 223.4ºC |
| Exact Mass | 223.08400 |
| PSA | 60.28000 |
| LogP | 1.12470 |
| Index of Refraction | 1.527 |
| InChIKey | FWUOYEHWFKJVPM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CNC(=O)O2)cc1OC |
|
~%
5-(3,4-Dimethox... CAS#:66892-82-8 |
| Literature: Jaiswal; Parmar Journal of Heterocyclic Chemistry, 1978 , vol. 15, # 3 p. 519 - 521 |
| 5-<3.4-Dimethoxy-phenyl>-2-oxaazolidinon |