tert-butyl 2-amino-5-bromobenzoate
Modify Date: 2025-10-04 19:20:46
tert-butyl 2-amino-5-bromobenzoate structure
|
Common Name | tert-butyl 2-amino-5-bromobenzoate | ||
|---|---|---|---|---|
| CAS Number | 668969-63-9 | Molecular Weight | 272.13800 | |
| Density | 1.393g/cm3 | Boiling Point | 318.754ºC at 760 mmHg | |
| Molecular Formula | C11H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.578ºC | |
| Name | tert-butyl 2-amino-5-bromobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 318.754ºC at 760 mmHg |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.13800 |
| Flash Point | 146.578ºC |
| Exact Mass | 271.02100 |
| PSA | 52.32000 |
| LogP | 3.56780 |
| Index of Refraction | 1.567 |
| InChIKey | OMHOTPHULFOYPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cc(Br)ccc1N |
| HS Code | 2922499990 |
|---|
|
~79%
tert-butyl 2-am... CAS#:668969-63-9 |
| Literature: PHARMACIA and UPJOHN COMPANY Patent: WO2004/18428 A1, 2004 ; Location in patent: Page 367-368 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| tert-butyl 2-azanyl-5-bromanyl-benzoate |
| tert-butyl 2-amino-5-bromo-benzoate |