2-(2,6-dimethylphenoxy)ethyl-trimethylazanium,bromide structure
|
Common Name | 2-(2,6-dimethylphenoxy)ethyl-trimethylazanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 669-49-8 | Molecular Weight | 288.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,6-dimethylphenoxy)ethyl-trimethylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22BrNO |
|---|---|
| Molecular Weight | 288.22400 |
| Exact Mass | 287.08800 |
| PSA | 9.23000 |
| InChIKey | ZFHWDLYDBITDJK-UHFFFAOYSA-M |
| SMILES | Cc1cccc(C)c1OCC[N+](C)(C)C.[Br-] |
|
~%
2-(2,6-dimethyl... CAS#:669-49-8 |
| Literature: Hey; Willey British Journal of Pharmacology and Chemotherapy, 1954 , vol. 9, p. 471,475 |
|
~%
2-(2,6-dimethyl... CAS#:669-49-8 |
| Literature: Hey; Willey British Journal of Pharmacology and Chemotherapy, 1954 , vol. 9, p. 471,475 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Xylocholine |
| TM 10 |
| Xylocholine bromide |
| 2,6-Xylyl ether bromide |
| Choline 2,6-xylyl ether bromide |