1H-Tetrazol-5-amine,1-cyclohexyl-N-phenyl- structure
|
Common Name | 1H-Tetrazol-5-amine,1-cyclohexyl-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 66907-72-0 | Molecular Weight | 243.30800 | |
| Density | 1.3g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C13H17N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 1-cyclohexyl-N-phenyltetrazol-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.30800 |
| Flash Point | 203.5ºC |
| Exact Mass | 243.14800 |
| PSA | 55.63000 |
| LogP | 2.99490 |
| Index of Refraction | 1.688 |
| InChIKey | MGWSFNPAEUNMKM-UHFFFAOYSA-N |
| SMILES | c1ccc(Nc2nnnn2C2CCCCC2)cc1 |
|
~%
1H-Tetrazol-5-a... CAS#:66907-72-0 |
| Literature: Finnegan et al. Journal of Organic Chemistry, 1953 , vol. 18, p. 779,784 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Anilino-1-cyclohexyltetrazole |
| 1H-Tetrazol-5-amine,1-cyclohexyl-N-phenyl |