2-Bromo-4,5-dimethoxy-N-[1-methyl-4-diethylaminobutyl]aniline structure
|
Common Name | 2-Bromo-4,5-dimethoxy-N-[1-methyl-4-diethylaminobutyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 66910-68-7 | Molecular Weight | 373.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H29BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-N-(2-bromo-4,5-dimethoxyphenyl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|
| Molecular Formula | C17H29BrN2O2 |
|---|---|
| Molecular Weight | 373.32800 |
| Exact Mass | 372.14100 |
| PSA | 33.73000 |
| LogP | 4.46170 |
| InChIKey | DNVIOYJGGDGNFA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1cc(OC)c(OC)cc1Br |
|
~%
2-Bromo-4,5-dim... CAS#:66910-68-7 |
| Literature: Yan; Burton; Chien; Cheng Journal of Heterocyclic Chemistry, 1978 , vol. 15, # 2 p. 297 - 300 |
|
~%
2-Bromo-4,5-dim... CAS#:66910-68-7 |
| Literature: Yan; Burton; Chien; Cheng Journal of Heterocyclic Chemistry, 1978 , vol. 15, # 2 p. 297 - 300 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |