2,4-Dichlor-4'-methoxy-benzophenon structure
|
Common Name | 2,4-Dichlor-4'-methoxy-benzophenon | ||
|---|---|---|---|---|
| CAS Number | 66938-30-5 | Molecular Weight | 281.13400 | |
| Density | 1.304g/cm3 | Boiling Point | 411.5ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.9ºC | |
| Name | 2,4-Dichlor-4'-methoxy-benzophenon |
|---|
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 168.9ºC |
| Exact Mass | 280.00600 |
| PSA | 26.30000 |
| LogP | 4.23300 |
| Index of Refraction | 1.588 |
| InChIKey | PUVDARQEKWTLFT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)cc2Cl)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
2,4-Dichlor-4'-... CAS#:66938-30-5 |
| Literature: Raeymackers; Van Gelder; Roevens; Janssen Arzneimittel-Forschung/Drug Research, 1978 , vol. 28, # 4 p. 586 - 594 |
|
~53%
2,4-Dichlor-4'-... CAS#:66938-30-5 |
| Literature: Bandgar; Sadavarte Synthetic Communications, 1999 , vol. 29, # 15 p. 2587 - 2590 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |