1-chloro-4-(1-chloro-2-cyclopropylpropan-2-yl)sulfanylbenzene structure
|
Common Name | 1-chloro-4-(1-chloro-2-cyclopropylpropan-2-yl)sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 66949-06-2 | Molecular Weight | 261.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14Cl2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-(1-chloro-2-cyclopropylpropan-2-yl)sulfanylbenzene |
|---|
| Molecular Formula | C12H14Cl2S |
|---|---|
| Molecular Weight | 261.21100 |
| Exact Mass | 260.01900 |
| PSA | 25.30000 |
| LogP | 4.83960 |
| InChIKey | PQCUHZHCLMNAQR-UHFFFAOYSA-N |
| SMILES | CC(CCl)(Sc1ccc(Cl)cc1)C1CC1 |
|
~%
1-chloro-4-(1-c... CAS#:66949-06-2 |
| Literature: Kal'yan, Yu.B.; Krimer, M.Z.; Smit, V.A.; Lutsenko, A.I. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1984 , vol. 33, # 10 p. 2113 - 2117 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1984 , # 10 p. 2314 - 2319 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |