(4-acetylamino-3-bromo-phenyl)-acetic acid
(4-acetylamino-3-bromo-phenyl)-acetic acid structure
|
Common Name | (4-acetylamino-3-bromo-phenyl)-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 66956-60-3 | Molecular Weight | 272.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-acetylamino-3-bromo-phenyl)-acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10BrNO3 |
|---|---|
| Molecular Weight | 272.09500 |
| Exact Mass | 270.98400 |
| PSA | 66.40000 |
| LogP | 2.10760 |
| InChIKey | GGBKBLCIMQPSCO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(CC(=O)O)cc1Br |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:66955-75-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (4-Acetylamino-3-brom-phenyl)-essigsaeure |
| 4-acetamido-3-bromophenylacetic acid |
| 3-Brom-4-acetamino-phenylessigsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: SMILES notation of (4-acetylamino-3-bromo-phenyl)-acetic acid is CC(=O)Nc1ccc(CC(=O)O)cc1Br. |
| Q: What is the LogP of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: LogP of (4-acetylamino-3-bromo-phenyl)-acetic acid is 2.10760. |
| Q: What is the CAS number of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: CAS number of (4-acetylamino-3-bromo-phenyl)-acetic acid is 66956-60-3. |
| Q: What is the InChIKey of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: InChIKey of (4-acetylamino-3-bromo-phenyl)-acetic acid is GGBKBLCIMQPSCO-UHFFFAOYSA-N. |
| Q: What are the downstream products of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: Related downstream products(CAS) of (4-acetylamino-3-bromo-phenyl)-acetic acid: 66955-75-7. |
| Q: What is the polar surface area (PSA) of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: Polar surface area (PSA) of (4-acetylamino-3-bromo-phenyl)-acetic acid is 66.40000. |
| Q: What is the English name of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: The English name of (4-acetylamino-3-bromo-phenyl)-acetic acid is (4-acetylamino-3-bromo-phenyl)-acetic acid. |
| Q: What is the molecular weight of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: Molecular weight of (4-acetylamino-3-bromo-phenyl)-acetic acid is 272.09500. |
| Q: What is the molecular formula of (4-acetylamino-3-bromo-phenyl)-acetic acid? |
| A: Molecular formula of (4-acetylamino-3-bromo-phenyl)-acetic acid is C10H10BrNO3. |
| Q: What English synonyms does (4-acetylamino-3-bromo-phenyl)-acetic acid have? |
| A: English synonyms of (4-acetylamino-3-bromo-phenyl)-acetic acid: (4-Acetylamino-3-brom-phenyl)-essigsaeure, 4-acetamido-3-bromophenylacetic acid, 3-Brom-4-acetamino-phenylessigsaeure. |