Benzoic acid, 4-methyl-3-[[(tetrahydro-2-furanyl)carbonyl]amino]- (9CI) structure
|
Common Name | Benzoic acid, 4-methyl-3-[[(tetrahydro-2-furanyl)carbonyl]amino]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 669704-14-7 | Molecular Weight | 249.26200 | |
| Density | 1.331g/cm3 | Boiling Point | 504.7ºC at 760 mmHg | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.1ºC | |
| Name | 4-methyl-3-[(tetrahydro-2-furanylcarbonyl)amino]benzoic acid() |
|---|
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 504.7ºC at 760 mmHg |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26200 |
| Flash Point | 259.1ºC |
| Exact Mass | 249.10000 |
| PSA | 75.63000 |
| LogP | 1.88370 |
| Index of Refraction | 1.617 |
| InChIKey | GKSYTSXHEUFQLG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)C1CCCO1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |