3-(4-nitrophenoxy)-1-propanol
3-(4-nitrophenoxy)-1-propanol structure
|
Common Name | 3-(4-nitrophenoxy)-1-propanol | ||
|---|---|---|---|---|
| CAS Number | 66971-02-6 | Molecular Weight | 197.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-nitrophenoxy)-1-propanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11NO4 |
|---|---|
| Molecular Weight | 197.18800 |
| Exact Mass | 197.06900 |
| PSA | 75.28000 |
| LogP | 1.87920 |
| InChIKey | XHRNQMMJGWBTBU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCO)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:13094-50-3
CAS#:100800-40-6
CAS#:79096-54-1
CAS#:452093-81-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Hydroxy-3-[4-nitro-phenoxy]-propan |
| 1-(3 hydroxypropoxy)-4-nitrobenzene |
| 3-(4-nitrophenoxy)propanol |
| (3-hydroxy-propyl)-(4-nitro-phenyl)-ether |
| 3-(4-nitrophenoxy)propan-1-ol |
| (3-Hydroxy-propyl)-(4-nitro-phenyl)-aether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(4-nitrophenoxy)-1-propanol? |
| A: LogP of 3-(4-nitrophenoxy)-1-propanol is 1.87920. |
| Q: What is the CAS number of 3-(4-nitrophenoxy)-1-propanol? |
| A: CAS number of 3-(4-nitrophenoxy)-1-propanol is 66971-02-6. |
| Q: What is the molecular formula of 3-(4-nitrophenoxy)-1-propanol? |
| A: Molecular formula of 3-(4-nitrophenoxy)-1-propanol is C9H11NO4. |
| Q: What is the InChIKey of 3-(4-nitrophenoxy)-1-propanol? |
| A: InChIKey of 3-(4-nitrophenoxy)-1-propanol is XHRNQMMJGWBTBU-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(4-nitrophenoxy)-1-propanol? |
| A: The English name of 3-(4-nitrophenoxy)-1-propanol is 3-(4-nitrophenoxy)-1-propanol. |
| Q: What is the molecular weight of 3-(4-nitrophenoxy)-1-propanol? |
| A: Molecular weight of 3-(4-nitrophenoxy)-1-propanol is 197.18800. |
| Q: What is the Chinese name of 66971-02-6? |
| A: Chinese name of 66971-02-6 is 66971-02-6. |
| Q: What is the SMILES notation of 3-(4-nitrophenoxy)-1-propanol? |
| A: SMILES notation of 3-(4-nitrophenoxy)-1-propanol is O=[N+]([O-])c1ccc(OCCCO)cc1. |
| Q: What English synonyms does 3-(4-nitrophenoxy)-1-propanol have? |
| A: English synonyms of 3-(4-nitrophenoxy)-1-propanol: 1-Hydroxy-3-[4-nitro-phenoxy]-propan, 1-(3 hydroxypropoxy)-4-nitrobenzene, 3-(4-nitrophenoxy)propanol, (3-hydroxy-propyl)-(4-nitro-phenyl)-ether, 3-(4-nitrophenoxy)propan-1-ol, (3-Hydroxy-propyl)-(4-nitro-phenyl)-aether. |
| Q: What is the polar surface area (PSA) of 3-(4-nitrophenoxy)-1-propanol? |
| A: Polar surface area (PSA) of 3-(4-nitrophenoxy)-1-propanol is 75.28000. |