trimethyl-[2-(2-methylphenoxy)ethyl]azanium,bromide structure
|
Common Name | trimethyl-[2-(2-methylphenoxy)ethyl]azanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 67-06-1 | Molecular Weight | 274.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2-(2-methylphenoxy)ethyl]azanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20BrNO |
|---|---|
| Molecular Weight | 274.19700 |
| Exact Mass | 273.07300 |
| PSA | 9.23000 |
| InChIKey | SJYDJVHITWHSES-UHFFFAOYSA-M |
| SMILES | Cc1ccccc1OCC[N+](C)(C)C.[Br-] |
|
~%
trimethyl-[2-(2... CAS#:67-06-1 |
| Literature: Goldfarb Journal of the American Chemical Society, 1941 , vol. 63, p. 2280 |
|
~%
trimethyl-[2-(2... CAS#:67-06-1 |
| Literature: Goldfarb Journal of the American Chemical Society, 1941 , vol. 63, p. 2280 |
| AMMONIUM,(2-(o-TOLYLOXY)ETHYL)TRIMETHYL-,BROMIDE |
| n,n,n-trimethyl-2-(2-methylphenoxy)ethanaminium bromide |
| trimethyl-(2-o-tolyloxy-ethyl)-ammonium,bromide |
| (2-(o-Tolyloxy)ethyl)trimethylammonium bromide |
| Trimethyl-(2-o-tolyloxy-aethyl)-ammonium,Bromid |
| TM 18 |
| Choline o-tolyl ether bromide |