1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol
Modify Date: 2026-09-13 02:22:42
![1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol Structure](https://www.chemsrc.com/extcaspic/130/67006-36-4.png)
1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol structure
|
Common Name | 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol | ||
|---|---|---|---|---|
| CAS Number | 67006-36-4 | Molecular Weight | 306.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H18O8S2 |
|---|---|
| Molecular Weight | 306.4 |
| InChIKey | GEYWGYLMKAPRSB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(CCO)CC(O)C(O)CS(=O)(=O)CCO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol? |
| A: The English name of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol is 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol. |
| Q: What is the Chinese name of 67006-36-4? |
| A: Chinese name of 67006-36-4 is 67006-36-4. |
| Q: What is the molecular weight of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol? |
| A: Molecular weight of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol is 306.4. |
| Q: What is the CAS number of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol? |
| A: CAS number of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol is 67006-36-4. |
| Q: What is the SMILES notation of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol? |
| A: SMILES notation of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol is O=S(=O)(CCO)CC(O)C(O)CS(=O)(=O)CCO. |
| Q: What is the molecular formula of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol? |
| A: Molecular formula of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol is C8H18O8S2. |
| Q: What is the InChIKey of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol? |
| A: InChIKey of 1,4-Bis[(2-hydroxyethyl)sulfonyl]-2,3-butanediol is GEYWGYLMKAPRSB-UHFFFAOYSA-N. |