GlcNAc(b1-3)aldehydo-Gal
Modify Date: 2026-07-31 06:45:04
GlcNAc(b1-3)aldehydo-Gal structure
|
Common Name | GlcNAc(b1-3)aldehydo-Gal | ||
|---|---|---|---|---|
| CAS Number | 67006-44-4 | Molecular Weight | 383.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | GlcNAc(b1-3)aldehydo-Gal |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25NO11 |
|---|---|
| Molecular Weight | 383.35 |
| InChIKey | MGEICUVBTAEZNP-BTQUHPNKSA-N |
| SMILES | CC(=O)NC1C(OC(C(O)C=O)C(O)C(O)CO)OC(CO)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 67006-44-4? |
| A: Chinese name of 67006-44-4 is 67006-44-4. |
| Q: What is the CAS number of GlcNAc(b1-3)aldehydo-Gal? |
| A: CAS number of GlcNAc(b1-3)aldehydo-Gal is 67006-44-4. |
| Q: What is the InChIKey of GlcNAc(b1-3)aldehydo-Gal? |
| A: InChIKey of GlcNAc(b1-3)aldehydo-Gal is MGEICUVBTAEZNP-BTQUHPNKSA-N. |
| Q: What is the SMILES notation of GlcNAc(b1-3)aldehydo-Gal? |
| A: SMILES notation of GlcNAc(b1-3)aldehydo-Gal is CC(=O)NC1C(OC(C(O)C=O)C(O)C(O)CO)OC(CO)C(O)C1O. |
| Q: What is the English name of GlcNAc(b1-3)aldehydo-Gal? |
| A: The English name of GlcNAc(b1-3)aldehydo-Gal is GlcNAc(b1-3)aldehydo-Gal. |
| Q: What is the molecular weight of GlcNAc(b1-3)aldehydo-Gal? |
| A: Molecular weight of GlcNAc(b1-3)aldehydo-Gal is 383.35. |
| Q: What is the molecular formula of GlcNAc(b1-3)aldehydo-Gal? |
| A: Molecular formula of GlcNAc(b1-3)aldehydo-Gal is C14H25NO11. |