Acetamide,N-[4-(2-oxoacetyl)phenyl] structure
|
Common Name | Acetamide,N-[4-(2-oxoacetyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 67014-06-6 | Molecular Weight | 191.18300 | |
| Density | 1.263 g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | N-(4-oxaldehydoylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263 g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18300 |
| Flash Point | 182.3ºC |
| Exact Mass | 191.05800 |
| PSA | 63.24000 |
| LogP | 1.09960 |
| Index of Refraction | 1.585 |
| InChIKey | MREMDXZTQRBMOE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)C=O)cc1 |
|
~%
Acetamide,N-[4-... CAS#:67014-06-6 |
| Literature: Musante; Parrini Gazzetta Chimica Italiana, 1951 , vol. 81, p. 451,457 Full Text Show Details Sakurai; Yoshino Yakugaku Zasshi, 1952 , vol. 72, p. 1294,1296 Chem.Abstr., 1953 , p. 6953 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-Acetylaminophenylglyoxal |
| 4-(N-acetylamino)phenylglyoxal |
| Essigsaeure-(4-glyoxyloyl-anilid) |
| Acetamide,N-[4-(oxoacetyl)phenyl] |
| acetic acid-(4-oxoacetyl-anilide) |
| N-[4-(2-Oxoacetyl)Phenyl]-Acetamide |