1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal
1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal structure
|
Common Name | 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal | ||
|---|---|---|---|---|
| CAS Number | 67019-51-6 | Molecular Weight | 264.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20O4 |
|---|---|
| Molecular Weight | 264.31700 |
| Exact Mass | 264.13600 |
| PSA | 47.92000 |
| LogP | 2.19990 |
| InChIKey | HZNDBUCVKYNBKR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(O)CCC3(CC2)OCCO3)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:5309-16-0![8-(4-methoxyphenyl)-1,4-dioxaspiro[4.5]dec-7-ene structure](https://image.chemsrc.com/caspic/060/67019-46-9.png)
CAS#:67019-46-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-hydroxy-4-(4-methoxyphenyl)cyclohexanonethylenketale |
| 4-hydroxy-4-(p-methoxyphenyl)cyclohexanone ethylene ketal |
| 8-(4-methoxy-phenyl)-1,4-dioxa-spiro[4.5]decan-8-ol |
| 4-hydroxy-4-(p-methoxyphenyl)-cyclohexanone ethylene ketal |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: InChIKey of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is HZNDBUCVKYNBKR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: Molecular weight of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is 264.31700. |
| Q: What is the polar surface area (PSA) of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: Polar surface area (PSA) of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is 47.92000. |
| Q: What is the SMILES notation of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: SMILES notation of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is COc1ccc(C2(O)CCC3(CC2)OCCO3)cc1. |
| Q: What are the downstream products of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: Related downstream products(CAS) of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal: 5309-16-0;67019-46-9. |
| Q: What is the molecular formula of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: Molecular formula of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is C15H20O4. |
| Q: What is the English name of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: The English name of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal. |
| Q: What is the Chinese name of 67019-51-6? |
| A: Chinese name of 67019-51-6 is 67019-51-6. |
| Q: What English synonyms does 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal have? |
| A: English synonyms of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal: 4-hydroxy-4-(4-methoxyphenyl)cyclohexanonethylenketale, 4-hydroxy-4-(p-methoxyphenyl)cyclohexanone ethylene ketal, 8-(4-methoxy-phenyl)-1,4-dioxa-spiro[4.5]decan-8-ol, 4-hydroxy-4-(p-methoxyphenyl)-cyclohexanone ethylene ketal. |
| Q: What is the LogP of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal? |
| A: LogP of 1-(4-methoxyphenyl)-1-hydroxycyclohexan-4-one ethylene ketal is 2.19990. |