naphthalene-1-acetic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | naphthalene-1-acetic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67026-10-2 | Molecular Weight | 335.39500 | |
| Density | N/A | Boiling Point | 373.2ºC at 760mmHg | |
| Molecular Formula | C18H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-naphthalen-1-ylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 373.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.39500 |
| Exact Mass | 335.17300 |
| PSA | 101.23000 |
| LogP | 0.73220 |
| InChIKey | JYSSLDLFRGGWFR-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc2ccccc12.OCCN(CCO)CCO |
| einecs 266-552-1 |