2-tert-butyl-1-cyano-3-[4-(dimethylamino)phenyl]guanidine structure
|
Common Name | 2-tert-butyl-1-cyano-3-[4-(dimethylamino)phenyl]guanidine | ||
|---|---|---|---|---|
| CAS Number | 67027-00-3 | Molecular Weight | 259.35000 | |
| Density | 1.02g/cm3 | Boiling Point | 377.6ºC at 760 mmHg | |
| Molecular Formula | C14H21N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.1ºC | |
| Name | 2-tert-butyl-1-cyano-3-[4-(dimethylamino)phenyl]guanidine |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760 mmHg |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.35000 |
| Flash Point | 182.1ºC |
| Exact Mass | 259.18000 |
| PSA | 63.45000 |
| LogP | 2.85358 |
| Index of Refraction | 1.54 |
| InChIKey | KMJKCCBUNDCOGC-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(NC(=NC(C)(C)C)NC#N)cc1 |
|
~%
2-tert-butyl-1-... CAS#:67027-00-3 |
| Literature: Petersen,H.J. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 773 - 781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |