JA2-3 (NSC29192) structure
|
Common Name | JA2-3 (NSC29192) | ||
|---|---|---|---|---|
| CAS Number | 6703-93-1 | Molecular Weight | 200.24100 | |
| Density | 1.88g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H4N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JA2-3 (NSC29192)JA2-3 (NSC29192) is a potent dose-dependent inhibitor of PARG with IC50 of 0.1 mM. |
| Name | 2,6-bis(sulfanylidene)-7,9-dihydro-3H-purin-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Molecular Formula | C5H4N4OS2 |
| Molecular Weight | 200.24100 |
| Exact Mass | 199.98300 |
| PSA | 144.41000 |
| LogP | 0.97140 |
| Index of Refraction | 1.904 |
| InChIKey | SOQYJXVHBQVRDB-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2[nH]c(=S)[nH]c(=S)c2[nH]1 |
|
~%
JA2-3 (NSC29192) CAS#:6703-93-1 |
| Literature: Noell; Robins Journal of the American Chemical Society, 1959 , vol. 81, p. 5997,5999,6006 |
|
~%
JA2-3 (NSC29192) CAS#:6703-93-1 |
| Literature: Garkuscha Zhurnal Obshchei Khimii, 1957 , vol. 27, p. 1712,1715;engl.Ausg.S.1783,1785 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-dithio-uric acid |
| 2,6-dithioxo-1,2,3,6,7,9-hexahydro-purin-8-one |
| 2,6-Dithio-harnsaeure |