1-ethenyl-4-[[(4-ethenylphenyl)methyldisulfanyl]methyl]benzene structure
|
Common Name | 1-ethenyl-4-[[(4-ethenylphenyl)methyldisulfanyl]methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 67030-83-5 | Molecular Weight | 298.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethenyl-4-[[(4-ethenylphenyl)methyldisulfanyl]methyl]benzene |
|---|
| Molecular Formula | C18H18S2 |
|---|---|
| Molecular Weight | 298.46600 |
| Exact Mass | 298.08500 |
| PSA | 50.60000 |
| LogP | 6.05420 |
| InChIKey | MFOUTNQFFOAIKG-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(CSSCc2ccc(C=C)cc2)cc1 |
|
~%
1-ethenyl-4-[[(... CAS#:67030-83-5 |
| Literature: Wulff,G.; Schulze,I. Israel Journal of Chemistry, 1978 , vol. 17, p. 291 - 297 |
|
~%
1-ethenyl-4-[[(... CAS#:67030-83-5 |
| Literature: Braslau, Rebecca; Rivera III, Frank; Tansakul, Chittreeya Reactive and Functional Polymers, 2013 , vol. 73, # 4 p. 624 - 633 |
|
~%
1-ethenyl-4-[[(... CAS#:67030-83-5 |
| Literature: Braslau, Rebecca; Rivera III, Frank; Tansakul, Chittreeya Reactive and Functional Polymers, 2013 , vol. 73, # 4 p. 624 - 633 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |