1-(3-Pyridyl)ethyl=benzoate structure
|
Common Name | 1-(3-Pyridyl)ethyl=benzoate | ||
|---|---|---|---|---|
| CAS Number | 67031-82-7 | Molecular Weight | 227.25900 | |
| Density | 1.144g/cm3 | Boiling Point | 357ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 1-pyridin-3-ylethyl benzoate |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 169.7ºC |
| Exact Mass | 227.09500 |
| PSA | 39.19000 |
| LogP | 2.99960 |
| Index of Refraction | 1.571 |
| InChIKey | PLSNYBSMHHRQBN-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)c1ccccc1)c1cccnc1 |
|
~74%
1-(3-Pyridyl)et... CAS#:67031-82-7 |
| Literature: Bellezza, Francesca; Cipiciani, Antonio; Cruciani, Gabriele; Fringuelli, Francesco Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 24 p. 4439 - 4444 |
|
~%
1-(3-Pyridyl)et... CAS#:67031-82-7 |
| Literature: Bellezza, Francesca; Cipiciani, Antonio; Cruciani, Gabriele; Fringuelli, Francesco Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 24 p. 4439 - 4444 |
|
~%
1-(3-Pyridyl)et... CAS#:67031-82-7 |
| Literature: Strong; McElvain Journal of the American Chemical Society, 1933 , vol. 55, p. 816,818 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |