3-(2-methylpiperidin-1-ium-1-yl)propyl 4-(2-phenylethoxy)benzoate,chloride structure
|
Common Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-(2-phenylethoxy)benzoate,chloride | ||
|---|---|---|---|---|
| CAS Number | 67032-00-2 | Molecular Weight | 417.96900 | |
| Density | N/A | Boiling Point | 516.1ºC at 760 mmHg | |
| Molecular Formula | C24H32ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.9ºC | |
| Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-(2-phenylethoxy)benzoate,chloride |
|---|
| Boiling Point | 516.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.96900 |
| Flash Point | 265.9ºC |
| Exact Mass | 417.20700 |
| PSA | 38.77000 |
| LogP | 5.46930 |
| InChIKey | CIOAIWMQORCKKW-UHFFFAOYSA-N |
| SMILES | CC1CCCC[NH+]1CCCOC(=O)c1ccc(OCCc2ccccc2)cc1.[Cl-] |
|
~%
3-(2-methylpipe... CAS#:67032-00-2 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
|
~%
3-(2-methylpipe... CAS#:67032-00-2 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |