3,5-Bis(butyrylamino)-2,4,6-triiodobenzoic acid structure
|
Common Name | 3,5-Bis(butyrylamino)-2,4,6-triiodobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 67032-30-8 | Molecular Weight | 670.02000 | |
| Density | 2.23g/cm3 | Boiling Point | 635.5ºC at 760 mmHg | |
| Molecular Formula | C15H17I3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.1ºC | |
| Name | 3,5-bis(butanoylamino)-2,4,6-triiodobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.23g/cm3 |
|---|---|
| Boiling Point | 635.5ºC at 760 mmHg |
| Molecular Formula | C15H17I3N2O4 |
| Molecular Weight | 670.02000 |
| Flash Point | 338.1ºC |
| Exact Mass | 669.83200 |
| PSA | 102.48000 |
| LogP | 5.97480 |
| Index of Refraction | 1.722 |
| InChIKey | MTYCANXGXKRMAI-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1c(I)c(NC(=O)CCC)c(I)c(C(=O)O)c1I |
|
~%
3,5-Bis(butyryl... CAS#:67032-30-8 |
| Literature: Larsen et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 3210,3215 |
| BENZOIC ACID,3,5-DIBUTYRAMIDO-2,4,6-TRIIODO |
| 3,5-Bis(butyrylamino)-2,4,6-triiodobenzoic acid |
| 3,5-Dibutyramido-2,4,6-triiodobenzoic acid |
| 3,5-Bis-butyrylamino-2,4,6-trijod-benzoesaeure |