3-(4-butoxy-3-methylbenzoyl)oxypropyl-dimethylazanium,chloride structure
|
Common Name | 3-(4-butoxy-3-methylbenzoyl)oxypropyl-dimethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 67032-41-1 | Molecular Weight | 329.86200 | |
| Density | N/A | Boiling Point | 397.7ºC at 760mmHg | |
| Molecular Formula | C17H28ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 3-(4-butoxy-3-methylbenzoyl)oxypropyl-dimethylazanium,chloride |
|---|
| Boiling Point | 397.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.86200 |
| Flash Point | 194.3ºC |
| Exact Mass | 329.17600 |
| PSA | 38.77000 |
| LogP | 4.08440 |
| InChIKey | IZXLHJDCLFVLLH-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C(=O)OCCC[NH+](C)C)cc1C.[Cl-] |
|
~%
3-(4-butoxy-3-m... CAS#:67032-41-1 |
| Literature: Squibb and Sons Patent: US2404691 , 1944 ; |
|
~%
3-(4-butoxy-3-m... CAS#:67032-41-1 |
| Literature: Squibb and Sons Patent: US2404691 , 1944 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |