3-(2-methylpiperidin-1-ium-1-yl)propyl 4-butan-2-yloxybenzoate,chloride structure
|
Common Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-butan-2-yloxybenzoate,chloride | ||
|---|---|---|---|---|
| CAS Number | 67032-48-8 | Molecular Weight | 369.92600 | |
| Density | N/A | Boiling Point | 444.6ºC at 760 mmHg | |
| Molecular Formula | C20H32ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-butan-2-yloxybenzoate,chloride |
|---|
| Boiling Point | 444.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H32ClNO3 |
| Molecular Weight | 369.92600 |
| Flash Point | 222.7ºC |
| Exact Mass | 369.20700 |
| PSA | 38.77000 |
| LogP | 5.02510 |
| InChIKey | WXKKIUUUZBDVJM-UHFFFAOYSA-N |
| SMILES | CCC(C)Oc1ccc(C(=O)OCCC[NH+]2CCCCC2C)cc1.[Cl-] |
|
~%
3-(2-methylpipe... CAS#:67032-48-8 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
|
~%
3-(2-methylpipe... CAS#:67032-48-8 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |