1-[2-(methoxymethoxy)-4,6-bis(phenylmethoxy)phenyl]ethanone structure
|
Common Name | 1-[2-(methoxymethoxy)-4,6-bis(phenylmethoxy)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 67052-53-3 | Molecular Weight | 392.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(methoxymethoxy)-4,6-bis(phenylmethoxy)phenyl]ethanone |
|---|
| Molecular Formula | C24H24O5 |
|---|---|
| Molecular Weight | 392.44400 |
| Exact Mass | 392.16200 |
| PSA | 53.99000 |
| LogP | 5.02990 |
| InChIKey | UIBKNSQZXDGRQU-UHFFFAOYSA-N |
| SMILES | COCOc1cc(OCc2ccccc2)cc(OCc2ccccc2)c1C(C)=O |
|
~84%
1-[2-(methoxyme... CAS#:67052-53-3 |
| Literature: Tsukayama, Masao; Li, He; Tsurumoto, Ken; Nishiuchi, Masaki; Kawamura, Yasuhiko Bulletin of the Chemical Society of Japan, 1998 , vol. 71, # 11 p. 2673 - 2680 |
|
~%
1-[2-(methoxyme... CAS#:67052-53-3 |
| Literature: Hossain, Mohammad M.; Kawamura, Yasuhiko; Yamashita, Kazuyo; Tsukayama, Masao Tetrahedron, 2006 , vol. 62, # 36 p. 8625 - 8635 |