N-(3-chlorophenyl)-N-hydroxybenzamide
N-(3-chlorophenyl)-N-hydroxybenzamide structure
|
Common Name | N-(3-chlorophenyl)-N-hydroxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 67055-91-8 | Molecular Weight | 247.67700 | |
| Density | 1.378g/cm3 | Boiling Point | 414.369ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.403ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-chlorophenyl)-N-hydroxybenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 414.369ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.67700 |
| Flash Point | 204.403ºC |
| Exact Mass | 247.04000 |
| PSA | 40.54000 |
| LogP | 3.37600 |
| Index of Refraction | 1.672 |
| InChIKey | MSKAAAQKUMGUHK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)N(O)c1cccc(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(3-chlorophen... CAS#:67055-91-8 |
| Literature: Ayyangar, N. R.; Brahme, K. C.; Kalkote, U. R.; Srinivasan, K. V. Synthesis, 1984 , # 11 p. 938 - 941 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 5 | |
CAS#:65-85-0
CAS#:608-27-5
CAS#:10286-77-8
CAS#:6626-75-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: CAS number of N-(3-chlorophenyl)-N-hydroxybenzamide is 67055-91-8. |
| Q: What is the English name of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: The English name of N-(3-chlorophenyl)-N-hydroxybenzamide is N-(3-chlorophenyl)-N-hydroxybenzamide. |
| Q: What is the Chinese name of 67055-91-8? |
| A: Chinese name of 67055-91-8 is 67055-91-8. |
| Q: What is the LogP of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: LogP of N-(3-chlorophenyl)-N-hydroxybenzamide is 3.37600. |
| Q: What are the upstream materials of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: Related upstream materials(CAS) of N-(3-chlorophenyl)-N-hydroxybenzamide: 10468-17-4;98-88-4. |
| Q: What is the molecular weight of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: Molecular weight of N-(3-chlorophenyl)-N-hydroxybenzamide is 247.67700. |
| Q: What is the boiling point of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: Boiling point of N-(3-chlorophenyl)-N-hydroxybenzamide is 414.369ºC at 760 mmHg. |
| Q: What is the molecular formula of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: Molecular formula of N-(3-chlorophenyl)-N-hydroxybenzamide is C13H10ClNO2. |
| Q: What are the downstream products of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: Related downstream products(CAS) of N-(3-chlorophenyl)-N-hydroxybenzamide: 10468-17-4;65-85-0;608-27-5;10286-77-8;6626-75-1. |
| Q: What is the InChIKey of N-(3-chlorophenyl)-N-hydroxybenzamide? |
| A: InChIKey of N-(3-chlorophenyl)-N-hydroxybenzamide is MSKAAAQKUMGUHK-UHFFFAOYSA-N. |