1,2-Ethanedione,1,2-bis(2-methoxyphenyl)- structure
|
Common Name | 1,2-Ethanedione,1,2-bis(2-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6706-92-9 | Molecular Weight | 270.28000 | |
| Density | 1.183g/cm3 | Boiling Point | 442.2ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.5ºC | |
| Name | 1,2-bis(2-methoxyphenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 442.2ºC at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 197.5ºC |
| Exact Mass | 270.08900 |
| PSA | 52.60000 |
| LogP | 2.76940 |
| Index of Refraction | 1.566 |
| InChIKey | PYDAJROJMZJKFS-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)C(=O)c1ccccc1OC |
| Storage condition | 2-8°C |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2'-Dimethoxy-benzil |
| o-methoxybenzil |
| 2,2'-dimethoxybenzyl |
| o-Anisil |