3-bromo-6-methyl-2,3-dihydrochromen-4-one
3-bromo-6-methyl-2,3-dihydrochromen-4-one structure
|
Common Name | 3-bromo-6-methyl-2,3-dihydrochromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 67064-52-2 | Molecular Weight | 241.08100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Bromo-6-methyl-2,3-dihydrochromen-4-one (CAS number: 67064-52-2), molecular formula C10H9BrO2, molecular weight 241.08100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-bromo-6-methyl-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrO2 |
|---|---|
| Molecular Weight | 241.08100 |
| Exact Mass | 239.97900 |
| PSA | 26.30000 |
| LogP | 2.33360 |
| InChIKey | AONRMXMEAUTDBT-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)C(Br)CO2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
3-bromo-6-methy... CAS#:67064-52-2 |
| Literature: Tandon, Vishnu K.; Awasthi, Anoop K.; Singh, Kunwar A.; Maurya, Hardesh K.; Gautam, Sanjay K. Heterocycles, 2010 , vol. 80, # 1 p. 593 - 600 |
|
~%
3-bromo-6-methy... CAS#:67064-52-2 |
| Literature: v. Auwers; Krollpfeiffer Chemische Berichte, 1914 , vol. 47, p. 2590 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:139449-20-0
CAS#:1450-72-2
CAS#:139449-22-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-BROMO-6-METHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-ONE |
| 3-Brom-6-methyl-chroman-4-on |
| 3-bromo-6-methyl-4-chromanone |
| 4H-1-Benzopyran-4-one,3-bromo-2,3-dihydro-6-methyl |
| 3-BROMO-6-METHYLCHROMAN-4-ONE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: Molecular weight of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is 241.08100. |
| Q: What is the English name of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: The English name of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is 3-bromo-6-methyl-2,3-dihydrochromen-4-one. |
| Q: What is the Chinese name of 67064-52-2? |
| A: Chinese name of 67064-52-2 is 67064-52-2. |
| Q: What is the InChIKey of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: InChIKey of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is AONRMXMEAUTDBT-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: Polar surface area (PSA) of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is 26.30000. |
| Q: What is the LogP of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: LogP of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is 2.33360. |
| Q: What is the molecular formula of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: Molecular formula of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is C10H9BrO2. |
| Q: What is the CAS number of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: CAS number of 3-bromo-6-methyl-2,3-dihydrochromen-4-one is 67064-52-2. |
| Q: What are the upstream materials of 3-bromo-6-methyl-2,3-dihydrochromen-4-one? |
| A: Related upstream materials(CAS) of 3-bromo-6-methyl-2,3-dihydrochromen-4-one: 39513-75-2;92-47-7. |
| Q: What English synonyms does 3-bromo-6-methyl-2,3-dihydrochromen-4-one have? |
| A: English synonyms of 3-bromo-6-methyl-2,3-dihydrochromen-4-one: 3-BROMO-6-METHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-ONE, 3-Brom-6-methyl-chroman-4-on, 3-bromo-6-methyl-4-chromanone, 4H-1-Benzopyran-4-one,3-bromo-2,3-dihydro-6-methyl, 3-BROMO-6-METHYLCHROMAN-4-ONE. |